C23H22Cl2N2O3 — CID 37446051
4-[[4-(2,4-dichlorobenzoyl)piperazin-1-yl]methyl]-7,8-dimethylchromen-2-one (PubChem CID 37446051) has the molecular formula C23H22Cl2N2O3 and a molecular weight of 445.35 g/mol. Its IUPAC name is 4-[[4-(2,4-dichlorobenzoyl)piperazin-1-yl]methyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[[4-(2,4-dichlorobenzoyl)piperazin-1-yl]methyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 37446051 |
| Molecular Formula | C23H22Cl2N2O3 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 4-[[4-(2,4-dichlorobenzoyl)piperazin-1-yl]methyl]-7,8-dimethylchromen-2-one |
| SMILES | Cc1ccc2c(CN3CCN(C(=O)c4ccc(Cl)cc4Cl)CC3)cc(=O)oc2c1C |
| InChI | InChI=1S/C23H22Cl2N2O3/c1-14-3-5-18-16(11-21(28)30-22(18)15(14)2)13-26-7-9-27(10-8-26)23(29)19-6-4-17(24)12-20(19)25/h3-6,11-12H,7-10,13H2,1-2H3 |
| InChIKey | RISXZYDLLQSKAC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|