C17H22Cl2N2O3 — CID 46406204
tert-butyl 2-[2-[(2,5-dichlorophenyl)carbamoyl]pyrrolidin-1-yl]acetate (PubChem CID 46406204) has the molecular formula C17H22Cl2N2O3 and a molecular weight of 373.28 g/mol. Its IUPAC name is tert-butyl 2-[2-[(2,5-dichlorophenyl)carbamoyl]pyrrolidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[2-[(2,5-dichlorophenyl)carbamoyl]pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 46406204 |
| Molecular Formula | C17H22Cl2N2O3 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | tert-butyl 2-[2-[(2,5-dichlorophenyl)carbamoyl]pyrrolidin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCCC1C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H22Cl2N2O3/c1-17(2,3)24-15(22)10-21-8-4-5-14(21)16(23)20-13-9-11(18)6-7-12(13)19/h6-7,9,14H,4-5,8,10H2,1-3H3,(H,20,23) |
| InChIKey | FUPGNQUPFGLNPM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |