C20H21Cl2N3O5 — CID 46405930
N-(2,5-dichlorophenyl)-1-[2-hydroxy-3-(3-nitrophenoxy)propyl]pyrrolidine-2-carboxamide (PubChem CID 46405930) has the molecular formula C20H21Cl2N3O5 and a molecular weight of 454.31 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-1-[2-hydroxy-3-(3-nitrophenoxy)propyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(2,5-dichlorophenyl)-1-[2-hydroxy-3-(3-nitrophenoxy)propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 46405930 |
| Molecular Formula | C20H21Cl2N3O5 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | N-(2,5-dichlorophenyl)-1-[2-hydroxy-3-(3-nitrophenoxy)propyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)C1CCCN1CC(O)COc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H21Cl2N3O5/c21-13-6-7-17(22)18(9-13)23-20(27)19-5-2-8-24(19)11-15(26)12-30-16-4-1-3-14(10-16)25(28)29/h1,3-4,6-7,9-10,15,19,26H,2,5,8,11-12H2,(H,23,27) |
| InChIKey | SUTAJQDGMLBILE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|