C21H26N2O6 — CID 55462529
1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-3-(3-nitrophenoxy)propan-2-ol (PubChem CID 55462529) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is 1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-3-(3-nitrophenoxy)propan-2-ol.
| Compound Name | 1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-3-(3-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 55462529 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-3-(3-nitrophenoxy)propan-2-ol |
| SMILES | COc1ccc(OC)c(C2CCCN2CC(O)COc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C21H26N2O6/c1-27-17-8-9-21(28-2)19(12-17)20-7-4-10-22(20)13-16(24)14-29-18-6-3-5-15(11-18)23(25)26/h3,5-6,8-9,11-12,16,20,24H,4,7,10,13-14H2,1-2H3 |
| InChIKey | WWAINHYDMWKBQN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|