C20H21N3O4S — CID 78814651
1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-(3-nitrophenoxy)propan-2-ol (PubChem CID 78814651) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-(3-nitrophenoxy)propan-2-ol.
| Compound Name | 1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-(3-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 78814651 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-3-(3-nitrophenoxy)propan-2-ol |
| SMILES | O=[N+]([O-])c1cccc(OCC(O)CN2CCCC2c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C20H21N3O4S/c24-15(13-27-16-6-3-5-14(11-16)23(25)26)12-22-10-4-8-18(22)20-21-17-7-1-2-9-19(17)28-20/h1-3,5-7,9,11,15,18,24H,4,8,10,12-13H2 |
| InChIKey | GNNAINKIQVWLST-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|