C16H24N2O4 — CID 9103497
(2S)-1-(azocan-1-yl)-3-(3-nitrophenoxy)propan-2-ol (PubChem CID 9103497) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is (2S)-1-(azocan-1-yl)-3-(3-nitrophenoxy)propan-2-ol.
| Compound Name | (2S)-1-(azocan-1-yl)-3-(3-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 9103497 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | (2S)-1-(azocan-1-yl)-3-(3-nitrophenoxy)propan-2-ol |
| SMILES | O=[N+]([O-])c1cccc(OC[C@@H](O)CN2CCCCCCC2)c1 |
| InChI | InChI=1S/C16H24N2O4/c19-15(12-17-9-4-2-1-3-5-10-17)13-22-16-8-6-7-14(11-16)18(20)21/h6-8,11,15,19H,1-5,9-10,12-13H2/t15-/m0/s1 |
| InChIKey | ZNXMKGOFYUYQAV-HNNXBMFYSA-N |
| XLogP | 2.60 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|