C16H20N4O4S — CID 31688819
(2R)-1-(3-nitrophenoxy)-3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propan-2-ol (PubChem CID 31688819) has the molecular formula C16H20N4O4S and a molecular weight of 364.43 g/mol. Its IUPAC name is (2R)-1-(3-nitrophenoxy)-3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-(3-nitrophenoxy)-3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 31688819 |
| Molecular Formula | C16H20N4O4S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (2R)-1-(3-nitrophenoxy)-3-[4-(1,3-thiazol-2-yl)piperazin-1-yl]propan-2-ol |
| SMILES | O=[N+]([O-])c1cccc(OC[C@H](O)CN2CCN(c3nccs3)CC2)c1 |
| InChI | InChI=1S/C16H20N4O4S/c21-14(12-24-15-3-1-2-13(10-15)20(22)23)11-18-5-7-19(8-6-18)16-17-4-9-25-16/h1-4,9-10,14,21H,5-8,11-12H2/t14-/m1/s1 |
| InChIKey | XXDUNVOFRHZYKZ-CQSZACIVSA-N |
| XLogP | 1.61 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|