C15H22N2O4 — CID 110931843
1-(2,2-dimethylpyrrolidin-1-yl)-3-(3-nitrophenoxy)propan-2-ol (PubChem CID 110931843) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 1-(2,2-dimethylpyrrolidin-1-yl)-3-(3-nitrophenoxy)propan-2-ol.
| Compound Name | 1-(2,2-dimethylpyrrolidin-1-yl)-3-(3-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 110931843 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1-(2,2-dimethylpyrrolidin-1-yl)-3-(3-nitrophenoxy)propan-2-ol |
| SMILES | CC1(C)CCCN1CC(O)COc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H22N2O4/c1-15(2)7-4-8-16(15)10-13(18)11-21-14-6-3-5-12(9-14)17(19)20/h3,5-6,9,13,18H,4,7-8,10-11H2,1-2H3 |
| InChIKey | SYUHLBZEVXVQAA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|