C19H15Cl2N3O6 — CID 46633736
5-(3,4-dichlorophenyl)-5-methyl-3-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]imidazolidine-2,4-dione (PubChem CID 46633736) has the molecular formula C19H15Cl2N3O6 and a molecular weight of 452.25 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-5-methyl-3-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(3,4-dichlorophenyl)-5-methyl-3-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46633736 |
| Molecular Formula | C19H15Cl2N3O6 |
| Molecular Weight | 452.25 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-5-methyl-3-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(Cl)c(Cl)c2)NC(=O)N(Cc2cc([N+](=O)[O-])cc3c2OCOC3)C1=O |
| InChI | InChI=1S/C19H15Cl2N3O6/c1-19(12-2-3-14(20)15(21)6-12)17(25)23(18(26)22-19)7-10-4-13(24(27)28)5-11-8-29-9-30-16(10)11/h2-6H,7-9H2,1H3,(H,22,26) |
| InChIKey | MPXUCWZOUHXPLL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|