C19H16N4O8 — CID 43075626
5-methyl-3-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-5-(3-nitrophenyl)imidazolidine-2,4-dione (PubChem CID 43075626) has the molecular formula C19H16N4O8 and a molecular weight of 428.36 g/mol. Its IUPAC name is 5-methyl-3-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-5-(3-nitrophenyl)imidazolidine-2,4-dione.
| Compound Name | 5-methyl-3-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-5-(3-nitrophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43075626 |
| Molecular Formula | C19H16N4O8 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 5-methyl-3-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]-5-(3-nitrophenyl)imidazolidine-2,4-dione |
| SMILES | CC1(c2cccc([N+](=O)[O-])c2)NC(=O)N(Cc2cc([N+](=O)[O-])cc3c2OCOC3)C1=O |
| InChI | InChI=1S/C19H16N4O8/c1-19(13-3-2-4-14(7-13)22(26)27)17(24)21(18(25)20-19)8-11-5-15(23(28)29)6-12-9-30-10-31-16(11)12/h2-7H,8-10H2,1H3,(H,20,25) |
| InChIKey | RIZIOVHQKQRFLD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 154.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|