C21H21ClN2O6 — CID 2106336
(5R)-3-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 2106336) has the molecular formula C21H21ClN2O6 and a molecular weight of 432.86 g/mol. Its IUPAC name is (5R)-3-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2106336 |
| Molecular Formula | C21H21ClN2O6 |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | (5R)-3-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc([C@@]2(C)NC(=O)N(Cc3cc(Cl)cc4c3OCOC4)C2=O)cc1OC |
| InChI | InChI=1S/C21H21ClN2O6/c1-21(14-4-5-16(27-2)17(8-14)28-3)19(25)24(20(26)23-21)9-12-6-15(22)7-13-10-29-11-30-18(12)13/h4-8H,9-11H2,1-3H3,(H,23,26)/t21-/m1/s1 |
| InChIKey | XFEHRXYGNIXIBQ-OAQYLSRUSA-N |
| XLogP | 3.19 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|