C22H23ClN2O4 — CID 55327606
5-butyl-3-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 55327606) has the molecular formula C22H23ClN2O4 and a molecular weight of 414.89 g/mol. Its IUPAC name is 5-butyl-3-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | 5-butyl-3-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55327606 |
| Molecular Formula | C22H23ClN2O4 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 5-butyl-3-[(6-chloro-4H-1,3-benzodioxin-8-yl)methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | CCCCC1(c2ccccc2)NC(=O)N(Cc2cc(Cl)cc3c2OCOC3)C1=O |
| InChI | InChI=1S/C22H23ClN2O4/c1-2-3-9-22(17-7-5-4-6-8-17)20(26)25(21(27)24-22)12-15-10-18(23)11-16-13-28-14-29-19(15)16/h4-8,10-11H,2-3,9,12-14H2,1H3,(H,24,27) |
| InChIKey | HDJTWGXPLKFHIS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|