C25H32N2O2 — CID 11417958
3-benzyl-5-nonyl-5-phenylimidazolidine-2,4-dione (PubChem CID 11417958) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is 3-benzyl-5-nonyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | 3-benzyl-5-nonyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11417958 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 3-benzyl-5-nonyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CCCCCCCCCC1(c2ccccc2)NC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C25H32N2O2/c1-2-3-4-5-6-7-14-19-25(22-17-12-9-13-18-22)23(28)27(24(29)26-25)20-21-15-10-8-11-16-21/h8-13,15-18H,2-7,14,19-20H2,1H3,(H,26,29) |
| InChIKey | TXPBTEHBCOSBGP-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|