C20H21N3O3 — CID 40820348
4-[[(4R)-2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl]methyl]benzamide (PubChem CID 40820348) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-[[(4R)-2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl]methyl]benzamide.
| Compound Name | 4-[[(4R)-2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 40820348 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 4-[[(4R)-2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl]methyl]benzamide |
| SMILES | CCC[C@]1(c2ccccc2)NC(=O)N(Cc2ccc(C(N)=O)cc2)C1=O |
| InChI | InChI=1S/C20H21N3O3/c1-2-12-20(16-6-4-3-5-7-16)18(25)23(19(26)22-20)13-14-8-10-15(11-9-14)17(21)24/h3-11H,2,12-13H2,1H3,(H2,21,24)(H,22,26)/t20-/m1/s1 |
| InChIKey | GDBVZMHUXLCIIR-HXUWFJFHSA-N |
| XLogP | 2.53 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|