C19H19FN2O2 — CID 7986927
(5S)-3-[(3-fluorophenyl)methyl]-5-phenyl-5-propylimidazolidine-2,4-dione (PubChem CID 7986927) has the molecular formula C19H19FN2O2 and a molecular weight of 326.37 g/mol. Its IUPAC name is (5S)-3-[(3-fluorophenyl)methyl]-5-phenyl-5-propylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(3-fluorophenyl)methyl]-5-phenyl-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7986927 |
| Molecular Formula | C19H19FN2O2 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (5S)-3-[(3-fluorophenyl)methyl]-5-phenyl-5-propylimidazolidine-2,4-dione |
| SMILES | CCC[C@@]1(c2ccccc2)NC(=O)N(Cc2cccc(F)c2)C1=O |
| InChI | InChI=1S/C19H19FN2O2/c1-2-11-19(15-8-4-3-5-9-15)17(23)22(18(24)21-19)13-14-7-6-10-16(20)12-14/h3-10,12H,2,11,13H2,1H3,(H,21,24)/t19-/m0/s1 |
| InChIKey | BQMJPRKEJFNCGA-IBGZPJMESA-N |
| XLogP | 3.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|