C23H27ClN2O2 — CID 70690995
3-benzyl-5-(3-chlorophenyl)-5-heptylimidazolidine-2,4-dione (PubChem CID 70690995) has the molecular formula C23H27ClN2O2 and a molecular weight of 398.93 g/mol. Its IUPAC name is 3-benzyl-5-(3-chlorophenyl)-5-heptylimidazolidine-2,4-dione.
| Compound Name | 3-benzyl-5-(3-chlorophenyl)-5-heptylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70690995 |
| Molecular Formula | C23H27ClN2O2 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 3-benzyl-5-(3-chlorophenyl)-5-heptylimidazolidine-2,4-dione |
| SMILES | CCCCCCCC1(c2cccc(Cl)c2)NC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C23H27ClN2O2/c1-2-3-4-5-9-15-23(19-13-10-14-20(24)16-19)21(27)26(22(28)25-23)17-18-11-7-6-8-12-18/h6-8,10-14,16H,2-5,9,15,17H2,1H3,(H,25,28) |
| InChIKey | BSSSSHXWODSLFD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|