C20H20FN3O4 — CID 112775560
5-butyl-5-(4-fluorophenyl)-3-[(3-nitrophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 112775560) has the molecular formula C20H20FN3O4 and a molecular weight of 385.40 g/mol. Its IUPAC name is 5-butyl-5-(4-fluorophenyl)-3-[(3-nitrophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-butyl-5-(4-fluorophenyl)-3-[(3-nitrophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 112775560 |
| Molecular Formula | C20H20FN3O4 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 5-butyl-5-(4-fluorophenyl)-3-[(3-nitrophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | CCCCC1(c2ccc(F)cc2)NC(=O)N(Cc2cccc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C20H20FN3O4/c1-2-3-11-20(15-7-9-16(21)10-8-15)18(25)23(19(26)22-20)13-14-5-4-6-17(12-14)24(27)28/h4-10,12H,2-3,11,13H2,1H3,(H,22,26) |
| InChIKey | PVPIZXYSMGOONZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|