C21H22F2N2O3 — CID 7621303
(5R)-5-butyl-3-[(3-fluoro-4-methoxyphenyl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione (PubChem CID 7621303) has the molecular formula C21H22F2N2O3 and a molecular weight of 388.41 g/mol. Its IUPAC name is (5R)-5-butyl-3-[(3-fluoro-4-methoxyphenyl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-butyl-3-[(3-fluoro-4-methoxyphenyl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7621303 |
| Molecular Formula | C21H22F2N2O3 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (5R)-5-butyl-3-[(3-fluoro-4-methoxyphenyl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione |
| SMILES | CCCC[C@]1(c2ccc(F)cc2)NC(=O)N(Cc2ccc(OC)c(F)c2)C1=O |
| InChI | InChI=1S/C21H22F2N2O3/c1-3-4-11-21(15-6-8-16(22)9-7-15)19(26)25(20(27)24-21)13-14-5-10-18(28-2)17(23)12-14/h5-10,12H,3-4,11,13H2,1-2H3,(H,24,27)/t21-/m1/s1 |
| InChIKey | LALXEBJSSUHONT-OAQYLSRUSA-N |
| XLogP | 4.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|