C34H42N4O2 — CID 11330140
3-[(4-benzhydrylpiperazin-1-yl)methyl]-5-heptyl-5-phenylimidazolidine-2,4-dione (PubChem CID 11330140) has the molecular formula C34H42N4O2 and a molecular weight of 538.74 g/mol. Its IUPAC name is 3-[(4-benzhydrylpiperazin-1-yl)methyl]-5-heptyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | 3-[(4-benzhydrylpiperazin-1-yl)methyl]-5-heptyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11330140 |
| Molecular Formula | C34H42N4O2 |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | 3-[(4-benzhydrylpiperazin-1-yl)methyl]-5-heptyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CCCCCCCC1(c2ccccc2)NC(=O)N(CN2CCN(C(c3ccccc3)c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C34H42N4O2/c1-2-3-4-5-15-22-34(30-20-13-8-14-21-30)32(39)38(33(40)35-34)27-36-23-25-37(26-24-36)31(28-16-9-6-10-17-28)29-18-11-7-12-19-29/h6-14,16-21,31H,2-5,15,22-27H2,1H3,(H,35,40) |
| InChIKey | PJQTYGPVOARZQL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|