C21H24FN3O2S — CID 26032001
(5R)-5-butyl-3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-5-(4-fluorophenyl)imidazolidine-2,4-dione (PubChem CID 26032001) has the molecular formula C21H24FN3O2S and a molecular weight of 401.51 g/mol. Its IUPAC name is (5R)-5-butyl-3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-5-(4-fluorophenyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-butyl-3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-5-(4-fluorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26032001 |
| Molecular Formula | C21H24FN3O2S |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (5R)-5-butyl-3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-5-(4-fluorophenyl)imidazolidine-2,4-dione |
| SMILES | CCCC[C@]1(c2ccc(F)cc2)NC(=O)N(CN2CCc3sccc3C2)C1=O |
| InChI | InChI=1S/C21H24FN3O2S/c1-2-3-10-21(16-4-6-17(22)7-5-16)19(26)25(20(27)23-21)14-24-11-8-18-15(13-24)9-12-28-18/h4-7,9,12H,2-3,8,10-11,13-14H2,1H3,(H,23,27)/t21-/m1/s1 |
| InChIKey | WFWBZMKROOGZAK-OAQYLSRUSA-N |
| XLogP | 3.84 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|