C23H33FN4O4 — CID 26002248
tert-butyl 4-[[(4R)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate (PubChem CID 26002248) has the molecular formula C23H33FN4O4 and a molecular weight of 448.54 g/mol. Its IUPAC name is tert-butyl 4-[[(4R)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(4R)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 26002248 |
| Molecular Formula | C23H33FN4O4 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | tert-butyl 4-[[(4R)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate |
| SMILES | CCCC[C@]1(c2ccc(F)cc2)NC(=O)N(CN2CCN(C(=O)OC(C)(C)C)CC2)C1=O |
| InChI | InChI=1S/C23H33FN4O4/c1-5-6-11-23(17-7-9-18(24)10-8-17)19(29)28(20(30)25-23)16-26-12-14-27(15-13-26)21(31)32-22(2,3)4/h7-10H,5-6,11-16H2,1-4H3,(H,25,30)/t23-/m1/s1 |
| InChIKey | IUYNIPSWIUDBQH-HSZRJFAPSA-N |
| XLogP | 3.27 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|