C22H38N4O4 — CID 35920548
tert-butyl 4-[(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]piperazine-1-carboxylate (PubChem CID 35920548) has the molecular formula C22H38N4O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is tert-butyl 4-[(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 35920548 |
| Molecular Formula | C22H38N4O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | tert-butyl 4-[(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CN2C(=O)NC3(CCC(C(C)(C)C)CC3)C2=O)CC1 |
| InChI | InChI=1S/C22H38N4O4/c1-20(2,3)16-7-9-22(10-8-16)17(27)26(18(28)23-22)15-24-11-13-25(14-12-24)19(29)30-21(4,5)6/h16H,7-15H2,1-6H3,(H,23,28) |
| InChIKey | IGGFUQJEXLOVRH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|