C20H32N4O5 — CID 24545807
tert-butyl 3-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)carbamoyl]piperidine-1-carboxylate (PubChem CID 24545807) has the molecular formula C20H32N4O5 and a molecular weight of 408.50 g/mol. Its IUPAC name is tert-butyl 3-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24545807 |
| Molecular Formula | C20H32N4O5 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | tert-butyl 3-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)carbamoyl]piperidine-1-carboxylate |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)C1CCCN(C(=O)OC(C)(C)C)C1)C2=O |
| InChI | InChI=1S/C20H32N4O5/c1-13-7-9-20(10-8-13)16(26)24(17(27)21-20)22-15(25)14-6-5-11-23(12-14)18(28)29-19(2,3)4/h13-14H,5-12H2,1-4H3,(H,21,27)(H,22,25) |
| InChIKey | CITUGBHIEAKMNW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|