C25H36N4O3 — CID 26012258
(3R)-1-[(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-N-phenylpiperidine-3-carboxamide (PubChem CID 26012258) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is (3R)-1-[(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-N-phenylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-[(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 26012258 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | (3R)-1-[(8-tert-butyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-N-phenylpiperidine-3-carboxamide |
| SMILES | CC(C)(C)C1CCC2(CC1)NC(=O)N(CN1CCC[C@@H](C(=O)Nc3ccccc3)C1)C2=O |
| InChI | InChI=1S/C25H36N4O3/c1-24(2,3)19-11-13-25(14-12-19)22(31)29(23(32)27-25)17-28-15-7-8-18(16-28)21(30)26-20-9-5-4-6-10-20/h4-6,9-10,18-19H,7-8,11-17H2,1-3H3,(H,26,30)(H,27,32)/t18-,19?,25?/m1/s1 |
| InChIKey | LYMFEOTYEZFKAH-VLNJMECTSA-N |
| XLogP | 3.82 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|