C21H29N5O3 — CID 51960930
(3R)-1-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-N-(6-methyl-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 51960930) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is (3R)-1-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-N-(6-methyl-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-N-(6-methyl-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 51960930 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | (3R)-1-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-N-(6-methyl-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)[C@@H]2CCCN(CN3C(=O)NC4(CCCCC4)C3=O)C2)n1 |
| InChI | InChI=1S/C21H29N5O3/c1-15-7-5-9-17(22-15)23-18(27)16-8-6-12-25(13-16)14-26-19(28)21(24-20(26)29)10-3-2-4-11-21/h5,7,9,16H,2-4,6,8,10-14H2,1H3,(H,24,29)(H,22,23,27)/t16-/m1/s1 |
| InChIKey | CNYBXSPCJCLTSM-MRXNPFEDSA-N |
| XLogP | 2.25 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|