C25H43N5O4 — CID 43020073
N-butyl-2-[4-[2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]piperazin-1-yl]acetamide (PubChem CID 43020073) has the molecular formula C25H43N5O4 and a molecular weight of 477.65 g/mol. Its IUPAC name is N-butyl-2-[4-[2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]piperazin-1-yl]acetamide.
| Compound Name | N-butyl-2-[4-[2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 43020073 |
| Molecular Formula | C25H43N5O4 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.33 |
| IUPAC Name | N-butyl-2-[4-[2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetyl]piperazin-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1CCN(C(=O)CN2C(=O)NC3(CCC(C(C)(C)CC)CC3)C2=O)CC1 |
| InChI | InChI=1S/C25H43N5O4/c1-5-7-12-26-20(31)17-28-13-15-29(16-14-28)21(32)18-30-22(33)25(27-23(30)34)10-8-19(9-11-25)24(3,4)6-2/h19H,5-18H2,1-4H3,(H,26,31)(H,27,34) |
| InChIKey | ZVRZXQIDAONJSV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|