C23H32ClN3O3S — CID 31441330
N-[2-(4-chlorophenyl)sulfanylethyl]-2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 31441330) has the molecular formula C23H32ClN3O3S and a molecular weight of 466.05 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 31441330 |
| Molecular Formula | C23H32ClN3O3S |
| Molecular Weight | 466.05 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | CCC(C)(C)C1CCC2(CC1)NC(=O)N(CC(=O)NCCSc1ccc(Cl)cc1)C2=O |
| InChI | InChI=1S/C23H32ClN3O3S/c1-4-22(2,3)16-9-11-23(12-10-16)20(29)27(21(30)26-23)15-19(28)25-13-14-31-18-7-5-17(24)6-8-18/h5-8,16H,4,9-15H2,1-3H3,(H,25,28)(H,26,30) |
| InChIKey | OEEQWTKFPPZXLO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.05 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|