C21H27FN4O5 — CID 46419163
tert-butyl 4-[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]piperazine-1-carboxylate (PubChem CID 46419163) has the molecular formula C21H27FN4O5 and a molecular weight of 434.47 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46419163 |
| Molecular Formula | C21H27FN4O5 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | tert-butyl 4-[2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)CN2C(=O)NC(C)(c3ccc(F)cc3)C2=O)CC1 |
| InChI | InChI=1S/C21H27FN4O5/c1-20(2,3)31-19(30)25-11-9-24(10-12-25)16(27)13-26-17(28)21(4,23-18(26)29)14-5-7-15(22)8-6-14/h5-8H,9-13H2,1-4H3,(H,23,29) |
| InChIKey | FZZIQVIOIKHTQK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|