C20H26FN3O5S — CID 92510445
2-[(4S)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 92510445) has the molecular formula C20H26FN3O5S and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-[(4S)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-[(4S)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 92510445 |
| Molecular Formula | C20H26FN3O5S |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2-[(4S)-4-butyl-4-(4-fluorophenyl)-2,5-dioxoimidazolidin-1-yl]-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | CCCC[C@@]1(c2ccc(F)cc2)NC(=O)N(CC(=O)N[C@@]2(C)CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C20H26FN3O5S/c1-3-4-9-20(14-5-7-15(21)8-6-14)17(26)24(18(27)23-20)12-16(25)22-19(2)10-11-30(28,29)13-19/h5-8H,3-4,9-13H2,1-2H3,(H,22,25)(H,23,27)/t19-,20-/m0/s1 |
| InChIKey | QYUFTCOSOHXTKX-PMACEKPBSA-N |
| XLogP | 1.46 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|