C14H13NO5S — CID 112780744
8-(furan-2-ylmethylsulfanylmethyl)-6-nitro-4H-1,3-benzodioxine (PubChem CID 112780744) has the molecular formula C14H13NO5S and a molecular weight of 307.33 g/mol. Its IUPAC name is 8-(furan-2-ylmethylsulfanylmethyl)-6-nitro-4H-1,3-benzodioxine.
| Compound Name | 8-(furan-2-ylmethylsulfanylmethyl)-6-nitro-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 112780744 |
| Molecular Formula | C14H13NO5S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 8-(furan-2-ylmethylsulfanylmethyl)-6-nitro-4H-1,3-benzodioxine |
| SMILES | O=[N+]([O-])c1cc2c(c(CSCc3ccco3)c1)OCOC2 |
| InChI | InChI=1S/C14H13NO5S/c16-15(17)12-4-10-6-18-9-20-14(10)11(5-12)7-21-8-13-2-1-3-19-13/h1-5H,6-9H2 |
| InChIKey | HCDTVPMGQUINQR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 74.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|