C18H15Cl2NO6S — CID 2740571
2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]ethyl 3,5-dichlorobenzoate (PubChem CID 2740571) has the molecular formula C18H15Cl2NO6S and a molecular weight of 444.29 g/mol. Its IUPAC name is 2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]ethyl 3,5-dichlorobenzoate.
| Compound Name | 2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]ethyl 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 2740571 |
| Molecular Formula | C18H15Cl2NO6S |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | 2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]ethyl 3,5-dichlorobenzoate |
| SMILES | O=C(OCCSCc1cc([N+](=O)[O-])cc2c1OCOC2)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H15Cl2NO6S/c19-14-3-11(4-15(20)7-14)18(22)26-1-2-28-9-13-6-16(21(23)24)5-12-8-25-10-27-17(12)13/h3-7H,1-2,8-10H2 |
| InChIKey | USUJYNAYQVYANV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|