C14H19N3O4S — CID 8776233
(6-nitro-4H-1,3-benzodioxin-8-yl)methyl N'-butylcarbamimidothioate (PubChem CID 8776233) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is (6-nitro-4H-1,3-benzodioxin-8-yl)methyl N'-butylcarbamimidothioate.
| Compound Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl N'-butylcarbamimidothioate |
|---|---|
| PubChem CID | 8776233 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (6-nitro-4H-1,3-benzodioxin-8-yl)methyl N'-butylcarbamimidothioate |
| SMILES | CCCC/N=C(\N)SCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C14H19N3O4S/c1-2-3-4-16-14(15)22-8-11-6-12(17(18)19)5-10-7-20-9-21-13(10)11/h5-6H,2-4,7-9H2,1H3,(H2,15,16) |
| InChIKey | TZNOHHXQEUAOAV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|