C16H16N2O6S2 — CID 2553347
ethyl 2-[2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1,3-thiazol-4-yl]acetate (PubChem CID 2553347) has the molecular formula C16H16N2O6S2 and a molecular weight of 396.45 g/mol. Its IUPAC name is ethyl 2-[2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 2553347 |
| Molecular Formula | C16H16N2O6S2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | ethyl 2-[2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(SCc2cc([N+](=O)[O-])cc3c2OCOC3)n1 |
| InChI | InChI=1S/C16H16N2O6S2/c1-2-23-14(19)5-12-8-26-16(17-12)25-7-11-4-13(18(20)21)3-10-6-22-9-24-15(10)11/h3-4,8H,2,5-7,9H2,1H3 |
| InChIKey | DIODCWQQPKEMDJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|