C13H11F3N4O4S2 — CID 48915285
5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-N-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 48915285) has the molecular formula C13H11F3N4O4S2 and a molecular weight of 408.38 g/mol. Its IUPAC name is 5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-N-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-N-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 48915285 |
| Molecular Formula | C13H11F3N4O4S2 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-N-(2,2,2-trifluoroethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | O=[N+]([O-])c1cc2c(c(CSc3nnc(NCC(F)(F)F)s3)c1)OCOC2 |
| InChI | InChI=1S/C13H11F3N4O4S2/c14-13(15,16)5-17-11-18-19-12(26-11)25-4-8-2-9(20(21)22)1-7-3-23-6-24-10(7)8/h1-2H,3-6H2,(H,17,18) |
| InChIKey | NNZFKSXDCVCSCA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|