C20H23N3O6S2 — CID 18776449
1-[[6-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-3-pyridinyl]sulfonyl]azepane (PubChem CID 18776449) has the molecular formula C20H23N3O6S2 and a molecular weight of 465.55 g/mol. Its IUPAC name is 1-[[6-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-3-pyridinyl]sulfonyl]azepane.
| Compound Name | 1-[[6-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-3-pyridinyl]sulfonyl]azepane |
|---|---|
| PubChem CID | 18776449 |
| Molecular Formula | C20H23N3O6S2 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 1-[[6-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-3-pyridinyl]sulfonyl]azepane |
| SMILES | O=[N+]([O-])c1cc2c(c(CSc3ccc(S(=O)(=O)N4CCCCCC4)cn3)c1)OCOC2 |
| InChI | InChI=1S/C20H23N3O6S2/c24-23(25)17-9-15-12-28-14-29-20(15)16(10-17)13-30-19-6-5-18(11-21-19)31(26,27)22-7-3-1-2-4-8-22/h5-6,9-11H,1-4,7-8,12-14H2 |
| InChIKey | WRINTYRQQMZNEQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|