C23H25N5O5S — CID 27763230
1-[4-(2-methoxyphenyl)-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1,2,4-triazol-3-yl]piperidine (PubChem CID 27763230) has the molecular formula C23H25N5O5S and a molecular weight of 483.55 g/mol. Its IUPAC name is 1-[4-(2-methoxyphenyl)-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1,2,4-triazol-3-yl]piperidine.
| Compound Name | 1-[4-(2-methoxyphenyl)-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1,2,4-triazol-3-yl]piperidine |
|---|---|
| PubChem CID | 27763230 |
| Molecular Formula | C23H25N5O5S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 1-[4-(2-methoxyphenyl)-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1,2,4-triazol-3-yl]piperidine |
| SMILES | COc1ccccc1-n1c(SCc2cc([N+](=O)[O-])cc3c2OCOC3)nnc1N1CCCCC1 |
| InChI | InChI=1S/C23H25N5O5S/c1-31-20-8-4-3-7-19(20)27-22(26-9-5-2-6-10-26)24-25-23(27)34-14-17-12-18(28(29)30)11-16-13-32-15-33-21(16)17/h3-4,7-8,11-12H,2,5-6,9-10,13-15H2,1H3 |
| InChIKey | SGSVAOHGQIQRNT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 104.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|