C22H23FN4O6S — CID 2423266
3-[(2-fluorophenoxy)methyl]-4-[(2S)-1-methoxypropan-2-yl]-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1,2,4-triazole (PubChem CID 2423266) has the molecular formula C22H23FN4O6S and a molecular weight of 490.51 g/mol. Its IUPAC name is 3-[(2-fluorophenoxy)methyl]-4-[(2S)-1-methoxypropan-2-yl]-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1,2,4-triazole.
| Compound Name | 3-[(2-fluorophenoxy)methyl]-4-[(2S)-1-methoxypropan-2-yl]-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 2423266 |
| Molecular Formula | C22H23FN4O6S |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 3-[(2-fluorophenoxy)methyl]-4-[(2S)-1-methoxypropan-2-yl]-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-1,2,4-triazole |
| SMILES | COC[C@H](C)n1c(COc2ccccc2F)nnc1SCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C22H23FN4O6S/c1-14(9-30-2)26-20(11-32-19-6-4-3-5-18(19)23)24-25-22(26)34-12-16-8-17(27(28)29)7-15-10-31-13-33-21(15)16/h3-8,14H,9-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | ZTKDSDRMXGXXQG-AWEZNQCLSA-N |
| XLogP | 4.27 |
| TPSA | 110.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|