C24H20N4O4S — CID 42411553
3-benzyl-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-4-phenyl-1,2,4-triazole (PubChem CID 42411553) has the molecular formula C24H20N4O4S and a molecular weight of 460.52 g/mol. Its IUPAC name is 3-benzyl-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-4-phenyl-1,2,4-triazole.
| Compound Name | 3-benzyl-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 42411553 |
| Molecular Formula | C24H20N4O4S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 3-benzyl-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-4-phenyl-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1cc2c(c(CSc3nnc(Cc4ccccc4)n3-c3ccccc3)c1)OCOC2 |
| InChI | InChI=1S/C24H20N4O4S/c29-28(30)21-12-18-14-31-16-32-23(18)19(13-21)15-33-24-26-25-22(11-17-7-3-1-4-8-17)27(24)20-9-5-2-6-10-20/h1-10,12-13H,11,14-16H2 |
| InChIKey | CCDZUERGEBGYHP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|