C24H21N3O5S — CID 5110095
1-(4-ethoxyphenyl)-2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]benzimidazole (PubChem CID 5110095) has the molecular formula C24H21N3O5S and a molecular weight of 463.52 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]benzimidazole.
| Compound Name | 1-(4-ethoxyphenyl)-2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]benzimidazole |
|---|---|
| PubChem CID | 5110095 |
| Molecular Formula | C24H21N3O5S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 1-(4-ethoxyphenyl)-2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]benzimidazole |
| SMILES | CCOc1ccc(-n2c(SCc3cc([N+](=O)[O-])cc4c3OCOC4)nc3ccccc32)cc1 |
| InChI | InChI=1S/C24H21N3O5S/c1-2-31-20-9-7-18(8-10-20)26-22-6-4-3-5-21(22)25-24(26)33-14-17-12-19(27(28)29)11-16-13-30-15-32-23(16)17/h3-12H,2,13-15H2,1H3 |
| InChIKey | NGGJNYAZEZUTDH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 88.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|