C22H17N3O6S — CID 2489884
3-(furan-2-ylmethyl)-2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]quinazolin-4-one (PubChem CID 2489884) has the molecular formula C22H17N3O6S and a molecular weight of 451.46 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(furan-2-ylmethyl)-2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 2489884 |
| Molecular Formula | C22H17N3O6S |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 3-(furan-2-ylmethyl)-2-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(SCc2cc([N+](=O)[O-])cc3c2OCOC3)n1Cc1ccco1 |
| InChI | InChI=1S/C22H17N3O6S/c26-21-18-5-1-2-6-19(18)23-22(24(21)10-17-4-3-7-30-17)32-12-15-9-16(25(27)28)8-14-11-29-13-31-20(14)15/h1-9H,10-13H2 |
| InChIKey | UKFPGBYCYIBMQE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 109.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|