C19H15N5O5S — CID 24522007
4-methyl-1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 24522007) has the molecular formula C19H15N5O5S and a molecular weight of 425.43 g/mol. Its IUPAC name is 4-methyl-1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 4-methyl-1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 24522007 |
| Molecular Formula | C19H15N5O5S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 4-methyl-1-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | Cn1c(=O)c2ccccc2n2c(SCc3cc([N+](=O)[O-])cc4c3OCOC4)nnc12 |
| InChI | InChI=1S/C19H15N5O5S/c1-22-17(25)14-4-2-3-5-15(14)23-18(22)20-21-19(23)30-9-12-7-13(24(26)27)6-11-8-28-10-29-16(11)12/h2-7H,8-10H2,1H3 |
| InChIKey | VYSRJYYRWGEMIG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 113.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|