C23H16ClN3O2S — CID 38867233
2-[(5-chloroquinolin-8-yl)methylsulfanyl]-3-(furan-2-ylmethyl)quinazolin-4-one (PubChem CID 38867233) has the molecular formula C23H16ClN3O2S and a molecular weight of 433.92 g/mol. Its IUPAC name is 2-[(5-chloroquinolin-8-yl)methylsulfanyl]-3-(furan-2-ylmethyl)quinazolin-4-one.
| Compound Name | 2-[(5-chloroquinolin-8-yl)methylsulfanyl]-3-(furan-2-ylmethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 38867233 |
| Molecular Formula | C23H16ClN3O2S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 2-[(5-chloroquinolin-8-yl)methylsulfanyl]-3-(furan-2-ylmethyl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(SCc2ccc(Cl)c3cccnc23)n1Cc1ccco1 |
| InChI | InChI=1S/C23H16ClN3O2S/c24-19-10-9-15(21-17(19)7-3-11-25-21)14-30-23-26-20-8-2-1-6-18(20)22(28)27(23)13-16-5-4-12-29-16/h1-12H,13-14H2 |
| InChIKey | UXVXIXGSDHEGIW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |