C22H18N2O4S — CID 19582578
3-[[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]-4-methoxybenzaldehyde (PubChem CID 19582578) has the molecular formula C22H18N2O4S and a molecular weight of 406.46 g/mol. Its IUPAC name is 3-[[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]-4-methoxybenzaldehyde.
| Compound Name | 3-[[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]-4-methoxybenzaldehyde |
|---|---|
| PubChem CID | 19582578 |
| Molecular Formula | C22H18N2O4S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 3-[[3-(furan-2-ylmethyl)-4-oxoquinazolin-2-yl]sulfanylmethyl]-4-methoxybenzaldehyde |
| SMILES | COc1ccc(C=O)cc1CSc1nc2ccccc2c(=O)n1Cc1ccco1 |
| InChI | InChI=1S/C22H18N2O4S/c1-27-20-9-8-15(13-25)11-16(20)14-29-22-23-19-7-3-2-6-18(19)21(26)24(22)12-17-5-4-10-28-17/h2-11,13H,12,14H2,1H3 |
| InChIKey | CVJJLEQTXUPDMF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|