C19H22N2O5 — CID 87014654
N-(furan-2-ylmethyl)-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]cyclopentanamine (PubChem CID 87014654) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]cyclopentanamine.
| Compound Name | N-(furan-2-ylmethyl)-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]cyclopentanamine |
|---|---|
| PubChem CID | 87014654 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-[(6-nitro-4H-1,3-benzodioxin-8-yl)methyl]cyclopentanamine |
| SMILES | O=[N+]([O-])c1cc2c(c(CN(Cc3ccco3)C3CCCC3)c1)OCOC2 |
| InChI | InChI=1S/C19H22N2O5/c22-21(23)17-8-14(19-15(9-17)12-24-13-26-19)10-20(16-4-1-2-5-16)11-18-6-3-7-25-18/h3,6-9,16H,1-2,4-5,10-13H2 |
| InChIKey | UYEVAWHFQCIEBJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 77.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|