C11H12Cl2OS2 — CID 107962795
1-(2,5-dichlorothiophen-3-yl)-2-(thian-4-yl)ethanone (PubChem CID 107962795) has the molecular formula C11H12Cl2OS2 and a molecular weight of 295.26 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-2-(thian-4-yl)ethanone.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-2-(thian-4-yl)ethanone |
|---|---|
| PubChem CID | 107962795 |
| Molecular Formula | C11H12Cl2OS2 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-2-(thian-4-yl)ethanone |
| SMILES | O=C(CC1CCSCC1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H12Cl2OS2/c12-10-6-8(11(13)16-10)9(14)5-7-1-3-15-4-2-7/h6-7H,1-5H2 |
| InChIKey | RCRIDYLKEZAWRQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |