C10H10Cl2O2S — CID 62139898
2-cyclobutyloxy-1-(2,5-dichlorothiophen-3-yl)ethanone (PubChem CID 62139898) has the molecular formula C10H10Cl2O2S and a molecular weight of 265.16 g/mol. Its IUPAC name is 2-cyclobutyloxy-1-(2,5-dichlorothiophen-3-yl)ethanone.
| Compound Name | 2-cyclobutyloxy-1-(2,5-dichlorothiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 62139898 |
| Molecular Formula | C10H10Cl2O2S |
| Molecular Weight | 265.16 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | 2-cyclobutyloxy-1-(2,5-dichlorothiophen-3-yl)ethanone |
| SMILES | O=C(COC1CCC1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H10Cl2O2S/c11-9-4-7(10(12)15-9)8(13)5-14-6-2-1-3-6/h4,6H,1-3,5H2 |
| InChIKey | HSBYZEZODGFEDP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.16 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |