C13H18Cl2O5S — CID 104563843
1-(2,5-dichlorothiophen-3-yl)-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethanone (PubChem CID 104563843) has the molecular formula C13H18Cl2O5S and a molecular weight of 357.26 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethanone.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethanone |
|---|---|
| PubChem CID | 104563843 |
| Molecular Formula | C13H18Cl2O5S |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethanone |
| SMILES | COCCOCCOCCOCC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C13H18Cl2O5S/c1-17-2-3-18-4-5-19-6-7-20-9-11(16)10-8-12(14)21-13(10)15/h8H,2-7,9H2,1H3 |
| InChIKey | OQJQZWOGEDQDHF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|