C14H20Cl2O2S — CID 43800418
1-(2,5-dichlorothiophen-3-yl)-2-(2-ethylhexoxy)ethanone (PubChem CID 43800418) has the molecular formula C14H20Cl2O2S and a molecular weight of 323.29 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-2-(2-ethylhexoxy)ethanone.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-2-(2-ethylhexoxy)ethanone |
|---|---|
| PubChem CID | 43800418 |
| Molecular Formula | C14H20Cl2O2S |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-2-(2-ethylhexoxy)ethanone |
| SMILES | CCCCC(CC)COCC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C14H20Cl2O2S/c1-3-5-6-10(4-2)8-18-9-12(17)11-7-13(15)19-14(11)16/h7,10H,3-6,8-9H2,1-2H3 |
| InChIKey | FJPHDMVPHQGBSF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |