C16H16Cl2O2S — CID 115492871
2-(4-butylphenoxy)-1-(2,5-dichlorothiophen-3-yl)ethanone (PubChem CID 115492871) has the molecular formula C16H16Cl2O2S and a molecular weight of 343.28 g/mol. Its IUPAC name is 2-(4-butylphenoxy)-1-(2,5-dichlorothiophen-3-yl)ethanone.
| Compound Name | 2-(4-butylphenoxy)-1-(2,5-dichlorothiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 115492871 |
| Molecular Formula | C16H16Cl2O2S |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 2-(4-butylphenoxy)-1-(2,5-dichlorothiophen-3-yl)ethanone |
| SMILES | CCCCc1ccc(OCC(=O)c2cc(Cl)sc2Cl)cc1 |
| InChI | InChI=1S/C16H16Cl2O2S/c1-2-3-4-11-5-7-12(8-6-11)20-10-14(19)13-9-15(17)21-16(13)18/h5-9H,2-4,10H2,1H3 |
| InChIKey | RADCFBBLHJPVPU-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |