C12H16Cl2O3S — CID 106666271
1-(2,5-dichlorothiophen-3-yl)-2-(3-methoxy-3-methylbutoxy)ethanone (PubChem CID 106666271) has the molecular formula C12H16Cl2O3S and a molecular weight of 311.23 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-2-(3-methoxy-3-methylbutoxy)ethanone.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-2-(3-methoxy-3-methylbutoxy)ethanone |
|---|---|
| PubChem CID | 106666271 |
| Molecular Formula | C12H16Cl2O3S |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-2-(3-methoxy-3-methylbutoxy)ethanone |
| SMILES | COC(C)(C)CCOCC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C12H16Cl2O3S/c1-12(2,16-3)4-5-17-7-9(15)8-6-10(13)18-11(8)14/h6H,4-5,7H2,1-3H3 |
| InChIKey | ZCXYKVNDSZWYPB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|